EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO2S |
| Net Charge | 0 |
| Average Mass | 209.270 |
| Monoisotopic Mass | 209.05105 |
| SMILES | OC[C@@H]1CSC(c2ccccc2O)=N1 |
| InChI | InChI=1S/C10H11NO2S/c12-5-7-6-14-10(11-7)8-3-1-2-4-9(8)13/h1-4,7,12-13H,5-6H2/t7-/m1/s1 |
| InChIKey | CQCVSXXDUMTFCR-SSDOTTSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces species CP32 (ncbitaxon:926355) | - | PubMed (21028889) | Organism was cultivated from Conus pulicarius |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aerugine (CHEBI:70579) has role metabolite (CHEBI:25212) |
| aerugine (CHEBI:70579) is a phenols (CHEBI:33853) |
| Synonym | Source |
|---|---|
| (6Z)-6-[(4R)-4-(hydroxymethyl)-1,3-thiazolidin-2-ylidene]cyclohexa-2,4-dien-1-one | ChEBI |
| Citations |
|---|