EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O3 |
| Net Charge | 0 |
| Average Mass | 316.441 |
| Monoisotopic Mass | 316.20384 |
| SMILES | [H][C@@]12CCc3cc(C(C)C)c(O)cc3[C@@]1(C(=O)O)CCCC2(C)C |
| InChI | InChI=1S/C20H28O3/c1-12(2)14-10-13-6-7-17-19(3,4)8-5-9-20(17,18(22)23)15(13)11-16(14)21/h10-12,17,21H,5-9H2,1-4H3,(H,22,23)/t17-,20-/m0/s1 |
| InChIKey | ATHWSPHADLLZSS-PXNSSMCTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fraxinus sieboldiana (ncbitaxon:490850) | stem (BTO:0001300) | PubMed (20961093) | Previous component: stem bark; EtOAc soluble fraction of 95% ethanolic extract of air-dried stem bark |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-pisiferic acid (CHEBI:70576) has role antibacterial agent (CHEBI:33282) |
| (+)-pisiferic acid (CHEBI:70576) has role plant metabolite (CHEBI:76924) |
| (+)-pisiferic acid (CHEBI:70576) is a abietane diterpenoid (CHEBI:36762) |
| (+)-pisiferic acid (CHEBI:70576) is a monocarboxylic acid (CHEBI:25384) |
| (+)-pisiferic acid (CHEBI:70576) is a phenols (CHEBI:33853) |
| (+)-pisiferic acid (CHEBI:70576) is a tricyclic diterpenoid (CHEBI:79084) |
| (+)-pisiferic acid (CHEBI:70576) is conjugate acid of (+)-pisiferate (CHEBI:167487) |
| Incoming Relation(s) |
| (+)-pisiferate (CHEBI:167487) is conjugate base of (+)-pisiferic acid (CHEBI:70576) |
| IUPAC Name |
|---|
| 12-hydroxyabieta-8,11,13-trien-20-oic acid |
| Synonym | Source |
|---|---|
| pisiferic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6893431 | Reaxys |
| CAS:67494-15-9 | ChemIDplus |
| CAS:67494-15-9 | KEGG COMPOUND |
| Citations |
|---|