EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O3 |
| Net Charge | 0 |
| Average Mass | 314.425 |
| Monoisotopic Mass | 314.18819 |
| SMILES | [H][C@@]12CC[C@@]34C=C(C(C)C)C(=O)C=C3[C@]1(CCCC2(C)C)C(=O)O4 |
| InChI | InChI=1S/C20H26O3/c1-12(2)13-11-19-9-6-15-18(3,4)7-5-8-20(15,17(22)23-19)16(19)10-14(13)21/h10-12,15H,5-9H2,1-4H3/t15-,19+,20+/m0/s1 |
| InChIKey | UFXFRAKIDXOMGU-CWFSZBLJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fraxinus sieboldiana (ncbitaxon:490850) | stem (BTO:0001300) | PubMed (20961093) | Previous component: stem bark; EtOAc soluble fraction of 95% ethanolic extract of air-dried stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-hydroxy-12-oxoabieta-9(11),13-dien-20-oic 8,20-lactone (CHEBI:70575) has role plant metabolite (CHEBI:76924) |
| 8-hydroxy-12-oxoabieta-9(11),13-dien-20-oic 8,20-lactone (CHEBI:70575) is a abietane diterpenoid (CHEBI:36762) |
| 8-hydroxy-12-oxoabieta-9(11),13-dien-20-oic 8,20-lactone (CHEBI:70575) is a cyclic terpene ketone (CHEBI:36130) |
| 8-hydroxy-12-oxoabieta-9(11),13-dien-20-oic 8,20-lactone (CHEBI:70575) is a diterpene lactone (CHEBI:49193) |
| IUPAC Name |
|---|
| 8,20-epoxyabieta-9(11),13-diene-12,20-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4882697 | Reaxys |
| Citations |
|---|