EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O |
| Net Charge | 0 |
| Average Mass | 284.443 |
| Monoisotopic Mass | 284.21402 |
| SMILES | [H][C@@]12CC(=O)c3cc(C(C)C)ccc3[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H28O/c1-13(2)14-7-8-16-15(11-14)17(21)12-18-19(3,4)9-6-10-20(16,18)5/h7-8,11,13,18H,6,9-10,12H2,1-5H3/t18-,20+/m0/s1 |
| InChIKey | ISHVJVXYPLFKAL-AZUAARDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fraxinus sieboldiana (ncbitaxon:490850) | stem (BTO:0001300) | PubMed (20961093) | Previous component: stem bark; EtOAc soluble fraction of 95% ethanolic extract of air-dried stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-dehydroabietanone (CHEBI:70574) has role plant metabolite (CHEBI:76924) |
| 7-dehydroabietanone (CHEBI:70574) is a abietane diterpenoid (CHEBI:36762) |
| 7-dehydroabietanone (CHEBI:70574) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| abieta-8,11,13-trien-7-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2129489 | Reaxys |
| Citations |
|---|