EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O3 |
| Net Charge | 0 |
| Average Mass | 328.452 |
| Monoisotopic Mass | 328.20384 |
| SMILES | [H][C@@]12C[C@@H](OCC)c3cc(C(C)C)c(O)cc3C1=CC(=O)CC2(C)C |
| InChI | InChI=1S/C21H28O3/c1-6-24-20-10-18-16(7-13(22)11-21(18,4)5)15-9-19(23)14(12(2)3)8-17(15)20/h7-9,12,18,20,23H,6,10-11H2,1-5H3/t18-,20-/m1/s1 |
| InChIKey | PBWYWMUNSHLHRZ-UYAOXDASSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fraxinus sieboldiana (ncbitaxon:490850) | stem (BTO:0001300) | PubMed (20961093) | Previous component: stem bark; EtOAc soluble fraction of 95% ethanolic extract of air-dried stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(5S,7R)-7-ethoxy-12-hydroxy-2-oxo-20-norabieta-1(10),8,11,13-tetraene (CHEBI:70572) has role plant metabolite (CHEBI:76924) |
| (+)-(5S,7R)-7-ethoxy-12-hydroxy-2-oxo-20-norabieta-1(10),8,11,13-tetraene (CHEBI:70572) is a cyclic terpene ketone (CHEBI:36130) |
| (+)-(5S,7R)-7-ethoxy-12-hydroxy-2-oxo-20-norabieta-1(10),8,11,13-tetraene (CHEBI:70572) is a ether (CHEBI:25698) |
| (+)-(5S,7R)-7-ethoxy-12-hydroxy-2-oxo-20-norabieta-1(10),8,11,13-tetraene (CHEBI:70572) is a phenols (CHEBI:33853) |
| (+)-(5S,7R)-7-ethoxy-12-hydroxy-2-oxo-20-norabieta-1(10),8,11,13-tetraene (CHEBI:70572) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| (9R,10aS)-9-ethoxy-6-hydroxy-1,1-dimethyl-7-(propan-2-yl)-1,9,10,10a-tetrahydrophenanthren-3(2H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21097457 | Reaxys |
| Citations |
|---|