EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O2 |
| Net Charge | 0 |
| Average Mass | 286.415 |
| Monoisotopic Mass | 286.19328 |
| SMILES | CC(C)c1cc2c(cc1O)C1=C(CC2)C(C)(C)CC[C@H]1O |
| InChI | InChI=1S/C19H26O2/c1-11(2)13-9-12-5-6-15-18(14(12)10-17(13)21)16(20)7-8-19(15,3)4/h9-11,16,20-21H,5-8H2,1-4H3/t16-/m1/s1 |
| InChIKey | VGYQUIDVXNWOOS-MRXNPFEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fraxinus sieboldiana (ncbitaxon:490850) | stem (BTO:0001300) | PubMed (20961093) | Previous component: stem bark; EtOAc soluble fraction of 95% ethanolic extract of air-dried stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(1R)-1,12-dihydroxy-20-norabieta-5(10),8,11,13-tetraene (CHEBI:70569) has role plant metabolite (CHEBI:76924) |
| (+)-(1R)-1,12-dihydroxy-20-norabieta-5(10),8,11,13-tetraene (CHEBI:70569) is a phenols (CHEBI:33853) |
| (+)-(1R)-1,12-dihydroxy-20-norabieta-5(10),8,11,13-tetraene (CHEBI:70569) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| (5R)-8,8-dimethyl-2-(propan-2-yl)-5,6,7,8,9,10-hexahydrophenanthrene-3,5-diol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21097455 | Reaxys |
| Citations |
|---|