EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O4 |
| Net Charge | 0 |
| Average Mass | 318.413 |
| Monoisotopic Mass | 318.18311 |
| SMILES | [H][C@@]12CC(=O)c3cc(C(C)C)c(O)cc3[C@@]1(O)CCC[C@]2(C)CO |
| InChI | InChI=1S/C19H26O4/c1-11(2)12-7-13-14(8-15(12)21)19(23)6-4-5-18(3,10-20)17(19)9-16(13)22/h7-8,11,17,20-21,23H,4-6,9-10H2,1-3H3/t17-,18+,19-/m0/s1 |
| InChIKey | RDRFKMSTCAZPEC-OTWHNJEPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fraxinus sieboldiana (ncbitaxon:490850) | stem (BTO:0001300) | PubMed (20961093) | Previous component: stem bark; EtOAc soluble fraction of 95% ethanolic extract of air-dried stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-(4S,5S,10R)-10,12,18-trihydroxy-7-oxo-20-norabieta-8,11,13-triene (CHEBI:70568) has role plant metabolite (CHEBI:76924) |
| (−)-(4S,5S,10R)-10,12,18-trihydroxy-7-oxo-20-norabieta-8,11,13-triene (CHEBI:70568) is a cyclic terpene ketone (CHEBI:36130) |
| (−)-(4S,5S,10R)-10,12,18-trihydroxy-7-oxo-20-norabieta-8,11,13-triene (CHEBI:70568) is a phenols (CHEBI:33853) |
| (−)-(4S,5S,10R)-10,12,18-trihydroxy-7-oxo-20-norabieta-8,11,13-triene (CHEBI:70568) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| (1S,4aR,10aS)-4a,6-dihydroxy-1-(hydroxymethyl)-1-methyl-7-(propan-2-yl)-2,3,4,4a,10,10a-hexahydrophenanthren-9(1H)-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21097467 | Reaxys |
| Citations |
|---|