EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O4 |
| Net Charge | 0 |
| Average Mass | 358.478 |
| Monoisotopic Mass | 358.21441 |
| SMILES | [H][C@@]12CC(=O)c3cc(C(C)C)c(O)cc3[C@@]13CCC[C@]2(C)CO[C@H]3OCC |
| InChI | InChI=1S/C22H30O4/c1-5-25-20-22-8-6-7-21(4,12-26-20)19(22)11-18(24)15-9-14(13(2)3)17(23)10-16(15)22/h9-10,13,19-20,23H,5-8,11-12H2,1-4H3/t19-,20+,21+,22-/m0/s1 |
| InChIKey | AVCUMQCXLPRLSN-CBPXPLCBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fraxinus sieboldiana (ncbitaxon:490850) | stem (BTO:0001300) | PubMed (20961093) | Previous component: stem bark; EtOAc soluble fraction of 95% ethanolic extract of air-dried stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-(4S,5S,10R,20R)-12,18-dihydroxy-7-oxo-abieta-8,11,13-trien-20-aldehyde 18,20-ethyl acetal (CHEBI:70565) has role plant metabolite (CHEBI:76924) |
| (−)-(4S,5S,10R,20R)-12,18-dihydroxy-7-oxo-abieta-8,11,13-trien-20-aldehyde 18,20-ethyl acetal (CHEBI:70565) is a abietane diterpenoid (CHEBI:36762) |
| (−)-(4S,5S,10R,20R)-12,18-dihydroxy-7-oxo-abieta-8,11,13-trien-20-aldehyde 18,20-ethyl acetal (CHEBI:70565) is a cyclic ether (CHEBI:37407) |
| (−)-(4S,5S,10R,20R)-12,18-dihydroxy-7-oxo-abieta-8,11,13-trien-20-aldehyde 18,20-ethyl acetal (CHEBI:70565) is a cyclic terpene ketone (CHEBI:36130) |
| (−)-(4S,5S,10R,20R)-12,18-dihydroxy-7-oxo-abieta-8,11,13-trien-20-aldehyde 18,20-ethyl acetal (CHEBI:70565) is a tetracyclic diterpenoid (CHEBI:52557) |
| IUPAC Name |
|---|
| (20R)-20-ethoxy-12-hydroxy-19,20-epoxyabieta-8,11,13-trien-7-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21097474 | Reaxys |
| Citations |
|---|