EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O3 |
| Net Charge | 0 |
| Average Mass | 314.425 |
| Monoisotopic Mass | 314.18819 |
| SMILES | [H][C@]12OC[C@@]3(C)CCC[C@@]14c1cc(O)c(C(C)C)cc1[C@]([H])(C[C@@]34[H])O2 |
| InChI | InChI=1S/C20H26O3/c1-11(2)12-7-13-14(8-15(12)21)20-6-4-5-19(3)10-22-18(20)23-16(13)9-17(19)20/h7-8,11,16-18,21H,4-6,9-10H2,1-3H3/t16-,17-,18+,19+,20-/m0/s1 |
| InChIKey | PNHPVNJXLPYREE-OMZCGLGVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fraxinus sieboldiana (ncbitaxon:490850) | stem (BTO:0001300) | PubMed (20961093) | Previous component: stem bark; EtOAc soluble fraction of 95% ethanolic extract of air-dried stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-(4S,5S,7S,10R,20S)-7,12,18-trihydroxyabieta-8,11,13-trien-20-aldehyde 7,18,20-acetal (CHEBI:70559) has role plant metabolite (CHEBI:76924) |
| (−)-(4S,5S,7S,10R,20S)-7,12,18-trihydroxyabieta-8,11,13-trien-20-aldehyde 7,18,20-acetal (CHEBI:70559) is a abietane diterpenoid (CHEBI:36762) |
| (−)-(4S,5S,7S,10R,20S)-7,12,18-trihydroxyabieta-8,11,13-trien-20-aldehyde 7,18,20-acetal (CHEBI:70559) is a bridged compound (CHEBI:35990) |
| (−)-(4S,5S,7S,10R,20S)-7,12,18-trihydroxyabieta-8,11,13-trien-20-aldehyde 7,18,20-acetal (CHEBI:70559) is a cyclic ether (CHEBI:37407) |
| IUPAC Name |
|---|
| (5S,6aS,9S,12aR,13S)-9-methyl-3-(propan-2-yl)-9,10,11,12-tetrahydro-5H,6aH,8H-9,12a,5-(ethane[1,1,2]triyl)oxocino[2,3-c][2]benzopyran-2-ol |
| Synonym | Source |
|---|---|
| (7α,20S)-7,20:18,20-diepoxyabieta-8,11,13-trien-12-ol | ChEBI |
| Citations |
|---|