EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O3 |
| Net Charge | 0 |
| Average Mass | 314.425 |
| Monoisotopic Mass | 314.18819 |
| SMILES | [H][C@@]12CCc3cc(C(C)C)c(O)cc3[C@@]13CCC[C@]2(C)COC3=O |
| InChI | InChI=1S/C20H26O3/c1-12(2)14-9-13-5-6-17-19(3)7-4-8-20(17,18(22)23-11-19)15(13)10-16(14)21/h9-10,12,17,21H,4-8,11H2,1-3H3/t17-,19+,20-/m0/s1 |
| InChIKey | KNTYFIJHKBRRFL-SXLOBPIMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fraxinus sieboldiana (ncbitaxon:490850) | stem (BTO:0001300) | PubMed (20961093) | Previous component: stem bark; EtOAc soluble fraction of 95% ethanolic extract of air-dried stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-(4S,5S,10R)-12,18-dihydroxyabieta-8,11,13-trien-20-oic acid-18,20-lactone (CHEBI:70555) has role plant metabolite (CHEBI:76924) |
| (−)-(4S,5S,10R)-12,18-dihydroxyabieta-8,11,13-trien-20-oic acid-18,20-lactone (CHEBI:70555) is a abietane diterpenoid (CHEBI:36762) |
| (−)-(4S,5S,10R)-12,18-dihydroxyabieta-8,11,13-trien-20-oic acid-18,20-lactone (CHEBI:70555) is a diterpene lactone (CHEBI:49193) |
| (−)-(4S,5S,10R)-12,18-dihydroxyabieta-8,11,13-trien-20-oic acid-18,20-lactone (CHEBI:70555) is a tetracyclic diterpenoid (CHEBI:52557) |
| IUPAC Name |
|---|
| 12-hydroxy-19,20-epoxyabieta-8,11,13-trien-20-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21097462 | Reaxys |
| Citations |
|---|