EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O4 |
| Net Charge | 0 |
| Average Mass | 328.408 |
| Monoisotopic Mass | 328.16746 |
| SMILES | [H][C@@]12O[C@@]13C=C(C(C)C)C(=O)C=C3[C@@]13CCCC(C)(C)[C@]1([H])[C@]2([H])OC3=O |
| InChI | InChI=1S/C20H24O4/c1-10(2)11-9-20-13(8-12(11)21)19-7-5-6-18(3,4)15(19)14(16(20)24-20)23-17(19)22/h8-10,14-16H,5-7H2,1-4H3/t14-,15-,16-,19-,20+/m0/s1 |
| InChIKey | CMURQFGSNXTIKZ-IEYYFSCXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fraxinus sieboldiana (ncbitaxon:490850) | stem (BTO:0001300) | PubMed (20961093) | Previous component: stem bark; EtOAc soluble fraction of 95% ethanolic extract of air-dried stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(5S,6S,7S,8R,10R)-6-hydroxy-7,8-epoxy-12-oxo-abieta-9(11),13-dien-20-oic acid 6,20-lactone (CHEBI:70554) has role plant metabolite (CHEBI:76924) |
| (+)-(5S,6S,7S,8R,10R)-6-hydroxy-7,8-epoxy-12-oxo-abieta-9(11),13-dien-20-oic acid 6,20-lactone (CHEBI:70554) is a abietane diterpenoid (CHEBI:36762) |
| (+)-(5S,6S,7S,8R,10R)-6-hydroxy-7,8-epoxy-12-oxo-abieta-9(11),13-dien-20-oic acid 6,20-lactone (CHEBI:70554) is a cyclic terpene ketone (CHEBI:36130) |
| (+)-(5S,6S,7S,8R,10R)-6-hydroxy-7,8-epoxy-12-oxo-abieta-9(11),13-dien-20-oic acid 6,20-lactone (CHEBI:70554) is a diterpene lactone (CHEBI:49193) |
| (+)-(5S,6S,7S,8R,10R)-6-hydroxy-7,8-epoxy-12-oxo-abieta-9(11),13-dien-20-oic acid 6,20-lactone (CHEBI:70554) is a epoxide (CHEBI:32955) |
| IUPAC Name |
|---|
| (4aR,5aS,6S,6aS,10aR)-7,7-dimethyl-3-(propan-2-yl)-6,6a,7,8,9,10-hexahydro-2H,5aH-6,10a-(epoxymethano)phenanthro[8a,9-b]oxirene-2,11-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21097459 | Reaxys |
| Citations |
|---|