EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H50O10 |
| Net Charge | 0 |
| Average Mass | 642.786 |
| Monoisotopic Mass | 642.34040 |
| SMILES | [H][C@@]12C=C(C)C(=O)[C@@]1(O)[C@H](O)[C@@]1(CO)O[C@@]1([H])[C@@]1([H])[C@H]3O[C@]4(/C=C/C=C/CCCCCCCCC)O[C@@]3(C(=C)C)[C@H](OC(C)=O)[C@@H](C)[C@]21O4 |
| InChI | InChI=1S/C36H50O10/c1-7-8-9-10-11-12-13-14-15-16-17-18-33-44-30-26-29-32(20-37,43-29)31(40)34(41)25(19-22(4)27(34)39)36(26,46-33)23(5)28(42-24(6)38)35(30,45-33)21(2)3/h15-19,23,25-26,28-31,37,40-41H,2,7-14,20H2,1,3-6H3/b16-15+,18-17+/t23-,25-,26+,28-,29+,30-,31-,32+,33?,34-,35+,36+/m1/s1 |
| InChIKey | ADIURPPZKNTYEV-PGLHEYDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pimelea simplex (ncbitaxon:746341) | - | PubMed (21049973) | |
| Pimelea elongata (IPNI:74472-3) | foliage leaf (PO:0009025) | PubMed (21049973) | Airdried and milled foliage was soaked in 90% MeOH and extracted with MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12beta-acetoxyhuratoxin (CHEBI:70551) has role metabolite (CHEBI:25212) |
| 12beta-acetoxyhuratoxin (CHEBI:70551) is a diterpenoid (CHEBI:23849) |
| Synonyms | Source |
|---|---|
| wikstroelide A | ChEBI |
| Pimelea simplex subtoxin A | ChEBI |
| Citations |
|---|