EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H48O8 |
| Net Charge | 0 |
| Average Mass | 584.750 |
| Monoisotopic Mass | 584.33492 |
| SMILES | [H][C@@]12C=C(C)C(=O)[C@@]1(O)[C@H](O)[C@@]1(CO)O[C@@]1([H])[C@@]1([H])[C@H]3O[C@@]4(/C=C/C=C/CCCCCCCCC)O[C@@]21[C@H](C)C[C@]3(C(=C)C)O4 |
| InChI | InChI=1S/C34H48O8/c1-6-7-8-9-10-11-12-13-14-15-16-17-32-40-27-25-28-31(20-35,39-28)29(37)33(38)24(18-22(4)26(33)36)34(25,42-32)23(5)19-30(27,41-32)21(2)3/h14-18,23-25,27-29,35,37-38H,2,6-13,19-20H2,1,3-5H3/b15-14+,17-16+/t23-,24-,25-,27-,28+,29-,30-,31+,32?,33-,34+/m1/s1 |
| InChIKey | VWGORPXMXKBHER-GPLJIMSFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pimelea elongata (IPNI:74472-3) | foliage leaf (PO:0009025) | PubMed (21049973) | Airdried and milled foliage was soaked in 90% MeOH and extracted with MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| huratoxin (CHEBI:70549) has role metabolite (CHEBI:25212) |
| huratoxin (CHEBI:70549) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| Huratoxin | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:33465-16-6 | KEGG COMPOUND |
| CAS:33465-16-6 | ChemIDplus |
| Citations |
|---|