EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O8 |
| Net Charge | 0 |
| Average Mass | 532.674 |
| Monoisotopic Mass | 532.30362 |
| SMILES | [H][C@@]12[C@H](C)C(=O)[C@@]3(O)[C@H](O)[C@@]4(CO)O[C@@]4([H])[C@@]4([H])[C@H]5O[C@@]6(CCCCCCC[C@@H]1C)O[C@@]4([C@H](C)C[C@]5(C(=C)C)O6)[C@]23[H] |
| InChI | InChI=1S/C30H44O8/c1-15(2)26-13-17(4)30-20-23(26)36-28(37-26,38-30)12-10-8-6-7-9-11-16(3)19-18(5)22(32)29(34,21(19)30)25(33)27(14-31)24(20)35-27/h16-21,23-25,31,33-34H,1,6-14H2,2-5H3/t16-,17+,18-,19-,20+,21+,23+,24-,25+,26+,27-,28?,29+,30+/m0/s1 |
| InChIKey | YTMZOVBDBJZQRD-FHUSGCSVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pimelea simplex (ncbitaxon:746341) | - | PubMed (21049973) | |
| Wikstroemia retusa (IPNI:833174-1) | - | PubMed (21049973) | |
| Pimelea elongata (IPNI:74472-3) | foliage leaf (PO:0009025) | PubMed (21049973) | Airdried and milled foliage was soaked in 90% MeOH and extracted with MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| wikstroelide E (CHEBI:70542) has role metabolite (CHEBI:25212) |
| wikstroelide E (CHEBI:70542) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| pimelea factor S7 | ChEBI |
| Citations |
|---|