EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H50O8 |
| Net Charge | 0 |
| Average Mass | 586.766 |
| Monoisotopic Mass | 586.35057 |
| SMILES | [H][C@@]12C=C(C)C(=O)[C@@]1(O)[C@H](O)[C@@]1(CO)O[C@@]1([H])[C@]1([H])[C@]2(O)[C@H](C)C[C@@]2(OC(=O)/C=C/C=C\CCCCCCCCC)C(C)(C)[C@@]12[H] |
| InChI | InChI=1S/C34H50O8/c1-6-7-8-9-10-11-12-13-14-15-16-17-24(36)41-32-19-22(3)33(39)23-18-21(2)27(37)34(23,40)29(38)31(20-35)28(42-31)25(33)26(32)30(32,4)5/h14-18,22-23,25-26,28-29,35,38-40H,6-13,19-20H2,1-5H3/b15-14-,17-16+/t22-,23+,25-,26-,28+,29-,31+,32+,33+,34-/m1/s1 |
| InChIKey | BRIOQTDLFXBKFB-WETQLOSTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pimelea simplex (ncbitaxon:746341) | - | PubMed (21049973) | |
| Pimelea elongata (IPNI:74472-3) | foliage leaf (PO:0009025) | PubMed (21049973) | Airdried and milled foliage was soaked in 90% MeOH and extracted with MeOH |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6alpha,7alpha-Epoxy-4beta,5beta,9alpha,20-tetrahydroxy-13alpha-(2E,4E)-tetradeca-2,4-dienoyl-1-tiglien-3-one (CHEBI:70539) has role metabolite (CHEBI:25212) |
| 6alpha,7alpha-Epoxy-4beta,5beta,9alpha,20-tetrahydroxy-13alpha-(2E,4E)-tetradeca-2,4-dienoyl-1-tiglien-3-one (CHEBI:70539) is a monoterpenoid (CHEBI:25409) |
| Synonym | Source |
|---|---|
| Pimelea simplex subtoxin B | ChEBI |
| Citations |
|---|