EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H48O4 |
| Net Charge | 0 |
| Average Mass | 448.688 |
| Monoisotopic Mass | 448.35526 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(C[C@H](O)[C@]3([H])[C@@](C)(O)CC[C@@H](C)C(C)C)[C@]1([H])[C@H](O)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C28H48O4/c1-16(2)17(3)7-12-28(6,32)25-23(31)15-21-24-20(9-11-27(21,25)5)26(4)10-8-19(29)13-18(26)14-22(24)30/h14,16-17,19-25,29-32H,7-13,15H2,1-6H3/t17-,19+,20+,21+,22-,23+,24-,25+,26+,27+,28+/m1/s1 |
| InChIKey | NAPNLPVMHUZNFG-BHTYWNIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Melia toosendan (ncbitaxon:71608) | fruit (BTO:0000486) | PubMed (20961091) | 95% ethanolic extract of dried fruits |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (20S)-5-ergostene-3beta,7alpha,16beta,20-tetrol (CHEBI:70532) has role metabolite (CHEBI:25212) |
| (20S)-5-ergostene-3beta,7alpha,16beta,20-tetrol (CHEBI:70532) is a ergostanoid (CHEBI:50403) |
| Citations |
|---|