EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H50O2 |
| Net Charge | 0 |
| Average Mass | 430.717 |
| Monoisotopic Mass | 430.38108 |
| SMILES | [H][C@]12CC[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CC[C@@H](CC)C(C)C)[C@]1([H])[C@@H](O)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C29H50O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-27-25(13-15-29(23,24)6)28(5)14-12-22(30)16-21(28)17-26(27)31/h17-20,22-27,30-31H,7-16H2,1-6H3/t19-,20-,22+,23-,24+,25+,26+,27+,28+,29-/m1/s1 |
| InChIKey | SXJVFYZNUGGHRG-PZHNMUJHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Melia toosendan (ncbitaxon:71608) | fruit (BTO:0000486) | PubMed (20961091) | 95% ethanolic extract of dried fruits |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7beta-hydroxysitosterol (CHEBI:70531) has parent hydride stigmastane (CHEBI:26773) |
| 7beta-hydroxysitosterol (CHEBI:70531) has role metabolite (CHEBI:25212) |
| 7beta-hydroxysitosterol (CHEBI:70531) is a C29-steroid (CHEBI:188923) |
| 7beta-hydroxysitosterol (CHEBI:70531) is a steroid (CHEBI:35341) |
| Synonym | Source |
|---|---|
| Stigmast-5-ene-3,7-diol, (3beta,7beta)- | ChEBI |
| Citations |
|---|