EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O6 |
| Net Charge | 0 |
| Average Mass | 516.719 |
| Monoisotopic Mass | 516.34509 |
| SMILES | [H][C@@]1([C@@H](C/C=C/C(C)(C)OO)C(=O)OC)[C@@H](O)C[C@]2(C)C3=CC[C@@]4([H])C(C)(C)C(=O)CC[C@]4(C)[C@@]3([H])CC[C@@]12C |
| InChI | InChI=1S/C31H48O6/c1-27(2,37-35)15-9-10-19(26(34)36-8)25-22(32)18-31(7)21-11-12-23-28(3,4)24(33)14-16-29(23,5)20(21)13-17-30(25,31)6/h9,11,15,19-20,22-23,25,32,35H,10,12-14,16-18H2,1-8H3/b15-9+/t19-,20+,22+,23+,25-,29-,30+,31-/m1/s1 |
| InChIKey | UXDZXRKJSZVQHR-GEMWEJHDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Melia toosendan (ncbitaxon:71608) | fruit (BTO:0000486) | PubMed (20961091) | 95% ethanolic extract of dried fruits |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meliastatin 3 (CHEBI:70527) has role metabolite (CHEBI:25212) |
| meliastatin 3 (CHEBI:70527) is a triterpenoid (CHEBI:36615) |
| Synonym | Source |
|---|---|
| Methyl (13alpha,14beta,16beta,17alpha,23E)-25-hydroperoxy-16-hydroxy-3-oxolanosta-7,23-dien-21-oate | ChEBI |
| Citations |
|---|