EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O5 |
| Net Charge | 0 |
| Average Mass | 484.677 |
| Monoisotopic Mass | 484.31887 |
| SMILES | [H][C@]12[C@]3(C)CC[C@@]4([H])C(=CC[C@@]5([H])C(C)(C)C(=O)CC[C@]45C)[C@@]3(C)C[C@]1([H])OC(=O)[C@]2([H])CC[C@H](OO)C(=C)C |
| InChI | InChI=1S/C30H44O5/c1-17(2)21(35-33)10-8-18-25-22(34-26(18)32)16-30(7)20-9-11-23-27(3,4)24(31)13-14-28(23,5)19(20)12-15-29(25,30)6/h9,18-19,21-23,25,33H,1,8,10-16H2,2-7H3/t18-,19+,21+,22+,23+,25-,28-,29+,30-/m1/s1 |
| InChIKey | HASDXLPYERWHOW-WOALYQRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Melia toosendan (ncbitaxon:71608) | fruit (BTO:0000486) | PubMed (20961091) | 95% ethanolic extract of dried fruits |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Meliasenin N (CHEBI:70522) has role metabolite (CHEBI:25212) |
| Meliasenin N (CHEBI:70522) is a triterpenoid (CHEBI:36615) |
| Synonym | Source |
|---|---|
| (24S)-hydroperoxyeupha-7,25-dien-3-oxo-16beta,21beta-olide | ChEBI |
| Citations |
|---|