EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@@]1([C@H](C)CCC(OO)C(=C)C)[C@@H](O)C[C@]2(C)C3=CC[C@@]4([H])C(C)(C)C(=O)CC[C@]4(C)[C@@]3([H])CC[C@@]12C |
| InChI | InChI=1S/C30H48O4/c1-18(2)23(34-33)11-9-19(3)26-22(31)17-30(8)21-10-12-24-27(4,5)25(32)14-15-28(24,6)20(21)13-16-29(26,30)7/h10,19-20,22-24,26,31,33H,1,9,11-17H2,2-8H3/t19-,20+,22+,23?,24+,26-,28-,29+,30-/m1/s1 |
| InChIKey | GMYOLHJETWNFPY-UUKLBSCWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Melia toosendan (ncbitaxon:71608) | fruit (BTO:0000486) | PubMed (20961091) | 95% ethanolic extract of dried fruits,obtained as a mixture of C-24 epimers |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Meliasenin L, (rel)- (CHEBI:70520) has role metabolite (CHEBI:25212) |
| Meliasenin L, (rel)- (CHEBI:70520) is a triterpenoid (CHEBI:36615) |
| Synonym | Source |
|---|---|
| rel-(20R,24RS)-hydroperoxyeupha-7,25-dien-16beta-ol-3-one | ChEBI |
| Citations |
|---|