EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2O4 |
| Net Charge | 0 |
| Average Mass | 370.449 |
| Monoisotopic Mass | 370.18926 |
| SMILES | [H][C@]12C[C@H](O)[C@@]34Nc5ccccc5[C@@]3(CCN4C/C1=C/C)[C@]2(CO)C(=O)OC |
| InChI | InChI=1S/C21H26N2O4/c1-3-13-11-23-9-8-20-14-6-4-5-7-16(14)22-21(20,23)17(25)10-15(13)19(20,12-24)18(26)27-2/h3-7,15,17,22,24-25H,8-12H2,1-2H3/b13-3-/t15-,17-,19-,20-,21-/m0/s1 |
| InChIKey | VZZBVNLFHYEUHM-CEYJTUKCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alstonia spatulata (IPNI:76595-1) | stem (BTO:0001300) | PubMed (21043460) | Previous component: stem bark; Extraction of stembark with concentrated EtOH with dilute acids |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N(4)-demethylechitamine (CHEBI:70513) has role metabolite (CHEBI:25212) |
| N(4)-demethylechitamine (CHEBI:70513) is a carbazoles (CHEBI:48513) |
| Citations |
|---|