EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N2O3 |
| Net Charge | 0 |
| Average Mass | 326.396 |
| Monoisotopic Mass | 326.16304 |
| SMILES | [H][C@]12CCNC[C@@]1(C=C)OC[C@@]2(C(=O)OC)c1cc2ccccc2n1 |
| InChI | InChI=1S/C19H22N2O3/c1-3-18-11-20-9-8-15(18)19(12-24-18,17(22)23-2)16-10-13-6-4-5-7-14(13)21-16/h3-7,10,15,20-21H,1,8-9,11-12H2,2H3/t15-,18+,19-/m0/s1 |
| InChIKey | KZLFAYYOKRWYDO-IPELMVKDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alstonia spatulata (IPNI:76595-1) | leaf (BTO:0000713) | PubMed (21043460) | Extraction of leaves with concentrated EtOH with dilute acids |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nor-6,7-secoangustilobine A, (rel)- (CHEBI:70502) has functional parent δ-amino acid (CHEBI:35931) |
| nor-6,7-secoangustilobine A, (rel)- (CHEBI:70502) has role metabolite (CHEBI:25212) |
| nor-6,7-secoangustilobine A, (rel)- (CHEBI:70502) is a organonitrogen compound (CHEBI:35352) |
| nor-6,7-secoangustilobine A, (rel)- (CHEBI:70502) is a organooxygen compound (CHEBI:36963) |
| Synonym | Source |
|---|---|
| rel-methyl(3S,3aR,7aS)-7a-ethenyl-3-(1H-indol-2-yl)-2,3a,4,5,6,7-hexahydrofuro[2,3-c]pyridine-3-carboxylate | ChEBI |
| Citations |
|---|