EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N2O2 |
| Net Charge | 0 |
| Average Mass | 322.408 |
| Monoisotopic Mass | 322.16813 |
| SMILES | [H][C@@]12C[C@@H]3N(CC[C@]34C(=C1C(=O)OC)Nc1ccccc14)C/C2=C/C |
| InChI | InChI=1S/C20H22N2O2/c1-3-12-11-22-9-8-20-14-6-4-5-7-15(14)21-18(20)17(19(23)24-2)13(12)10-16(20)22/h3-7,13,16,21H,8-11H2,1-2H3/b12-3-/t13-,16-,20+/m0/s1 |
| InChIKey | AGZMFTKKLPHOMT-DUJTVWLASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alstonia spatulata (IPNI:76595-1) | |||
| bark (BTO:0001301) | PubMed (21043460) | Isolated from stem bark. | |
| leaf (BTO:0000713) | PubMed (21043460) | ||
| Catharanthus roseus (ncbitaxon:4058) | aerial part (BTO:0001658) | PubMed (29152344) | |
| Rauvolfia caffra (ncbitaxon:947877) | bark (BTO:0001301) | PubMed (6471882) | Isolated from stem bark. |
| Alstonia angustifolia (IPNI:76506-1) | bark (BTO:0001301) | PubMed (17262459) | Isolated from stem bark. |
| Vinca major (ncbitaxon:185238) | leaf (BTO:0000713) | PubMed (17402086) | |
| Picralima nitida (ncbitaxon:52846) | seed (PO:0009010) | PubMed (9683021) | |
| Alstonia scholaris (ncbitaxon:52822) | bark (BTO:0001301) | Article (Boonchuay, W. and Court, W.E. (1976) Minor alkaloids of Alstonia scholaris root. Phytochemistry, 15, 821.) | Isolated from root bark. |
| Tabernaemontana divaricata (ncbitaxon:52861) | - | PubMed (17253850) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| akuammicine (CHEBI:70499) has role plant metabolite (CHEBI:76924) |
| akuammicine (CHEBI:70499) is a methyl ester (CHEBI:25248) |
| akuammicine (CHEBI:70499) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| akuammicine (CHEBI:70499) is a organic heteropentacyclic compound (CHEBI:38164) |
| akuammicine (CHEBI:70499) is a tertiary amino compound (CHEBI:50996) |
| akuammicine (CHEBI:70499) is conjugate base of akuammicine(1+) (CHEBI:142754) |
| Incoming Relation(s) |
| akuammicine(1+) (CHEBI:142754) is conjugate acid of akuammicine (CHEBI:70499) |
| IUPAC Name |
|---|
| methyl (19E)-2,16-didehydrocur-19-en-17-oate |
| Synonyms | Source |
|---|---|
| methyl (19E)-2,16,19,20-tetradehydrocuran-17-oate | ChemIDplus |
| (−)-akuammicine | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C09025 | KEGG COMPOUND |
| C00001680 | KNApSAcK |
| Akuammicine | Wikipedia |
| CPD-21553 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:639-43-0 | KEGG COMPOUND |
| CAS:639-43-0 | ChemIDplus |
| Citations |
|---|