EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N2O5 |
| Net Charge | 0 |
| Average Mass | 398.459 |
| Monoisotopic Mass | 398.18417 |
| SMILES | [H][C@]12CCN(C(=O)OCC)C[C@@]1(C=C)OC[C@@]2(C(=O)OC)c1cc2ccccc2n1 |
| InChI | InChI=1S/C22H26N2O5/c1-4-21-13-24(20(26)28-5-2)11-10-17(21)22(14-29-21,19(25)27-3)18-12-15-8-6-7-9-16(15)23-18/h4,6-9,12,17,23H,1,5,10-11,13-14H2,2-3H3/t17-,21+,22-/m0/s1 |
| InChIKey | XMPQHDBGVZIIJS-WTOYTKOKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alstonia spatulata (IPNI:76595-1) | leaf (BTO:0000713) | PubMed (21043460) | Extraction of leaves with concentrated EtOH with dilute acids |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Alstolobine A, (rel)- (CHEBI:70497) has role metabolite (CHEBI:25212) |
| Alstolobine A, (rel)- (CHEBI:70497) is a indoles (CHEBI:24828) |
| Citations |
|---|