EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O7 |
| Net Charge | 0 |
| Average Mass | 356.330 |
| Monoisotopic Mass | 356.08960 |
| SMILES | O=C(CC(CO)C(=O)c1ccc2c(c1)OCO2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H16O7/c20-8-13(19(22)12-2-4-16-18(7-12)26-10-24-16)5-14(21)11-1-3-15-17(6-11)25-9-23-15/h1-4,6-7,13,20H,5,8-10H2 |
| InChIKey | YNDXXIPMXGSUGT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper sanguineispicum (IPNI:199083-2) | leaf (BTO:0000713) | PubMed (20954722) | 90% ethanolic extract of dried leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Justiflorinol (CHEBI:70491) has role metabolite (CHEBI:25212) |
| Justiflorinol (CHEBI:70491) is a phenylpropanoid (CHEBI:26004) |
| Synonym | Source |
|---|---|
| 1,4-bis(1,3-benzodioxol-5-yl)-2-(hydroxymethyl)butane-1,4-dione | ChEBI |
| Citations |
|---|