EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O6 |
| Net Charge | 0 |
| Average Mass | 358.390 |
| Monoisotopic Mass | 358.14164 |
| SMILES | OC[C@@H](Cc1ccc2c(c1)OCO2)[C@@H](CO)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H22O6/c21-9-15(5-13-1-3-17-19(7-13)25-11-23-17)16(10-22)6-14-2-4-18-20(8-14)26-12-24-18/h1-4,7-8,15-16,21-22H,5-6,9-12H2/t15-,16-/m1/s1 |
| InChIKey | JKCVMTYNARDGET-HZPDHXFCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper sanguineispicum (IPNI:199083-2) | leaf (BTO:0000713) | PubMed (20954722) | 90% ethanolic extract of dried leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydrocubebin, rel- (CHEBI:70490) has role metabolite (CHEBI:25212) |
| Dihydrocubebin, rel- (CHEBI:70490) is a lignan (CHEBI:25036) |
| Synonym | Source |
|---|---|
| rel-1,4-Butanediol, 2,3-bis(1,3-benzodioxol-5-ylmethyl)-, (R-(R,R))- | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:24563-03-9 | ChemIDplus |
| Citations |
|---|