EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O8 |
| Net Charge | 0 |
| Average Mass | 384.340 |
| Monoisotopic Mass | 384.08452 |
| SMILES | [H][C@]1(C(=O)c2ccc3c(c2)OCO3)C(=O)OC[C@@]1([H])[C@H](O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H16O8/c21-18(10-1-3-13-15(5-10)27-8-25-13)12-7-24-20(23)17(12)19(22)11-2-4-14-16(6-11)28-9-26-14/h1-6,12,17-18,21H,7-9H2/t12-,17+,18-/m1/s1 |
| InChIKey | VFLHIZSORMIUMV-OCBCSQNSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper sanguineispicum (IPNI:199083-2) | leaf (BTO:0000713) | PubMed (20954722) | 90% ethanolic extract of dried leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-sanguinolignan B (CHEBI:70486) has role plant metabolite (CHEBI:76924) |
| (−)-sanguinolignan B (CHEBI:70486) is a benzodioxoles (CHEBI:38298) |
| (−)-sanguinolignan B (CHEBI:70486) is a lignan (CHEBI:25036) |
| (−)-sanguinolignan B (CHEBI:70486) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (3S,4S)-3-(2H-1,3-benzodioxole-5-carbonyl)-4-[(S)-(2H-1,3-benzodioxol-5-yl)(hydroxy)methyl]oxolan-2-one |
| Synonym | Source |
|---|---|
| (−)-(8S,7'S,8'S)-3,3',4,4'-bis(methylenedioxy)-7'-hydroxy-7-oxolignano-9,9'-lactone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21092029 | Reaxys |
| Citations |
|---|