EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O4 |
| Net Charge | 0 |
| Average Mass | 278.348 |
| Monoisotopic Mass | 278.15181 |
| SMILES | CCCCC[C@H](C)OC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H22O4/c1-3-4-5-6-12(2)20-16(19)10-8-13-7-9-14(17)15(18)11-13/h7-12,17-18H,3-6H2,1-2H3/b10-8+/t12-/m0/s1 |
| InChIKey | NCSRSZJMEGATGP-OANVXVOSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper sanguineispicum (IPNI:199083-2) | leaf (BTO:0000713) | PubMed (20954722) | 90% ethanolic extract of dried leaves |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-1'-methylhexyl caffeate (CHEBI:70483) has role plant metabolite (CHEBI:76924) |
| (S)-1'-methylhexyl caffeate (CHEBI:70483) is a alkyl caffeate ester (CHEBI:65331) |
| IUPAC Name |
|---|
| (2S)-heptan-2-yl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21092026 | Reaxys |
| Citations |
|---|