EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18O6 |
| Net Charge | 0 |
| Average Mass | 222.237 |
| Monoisotopic Mass | 222.11034 |
| SMILES | CC(C)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C9H18O6/c1-4(2)14-9-8(13)7(12)6(11)5(3-10)15-9/h4-13H,3H2,1-2H3/t5-,6-,7+,8-,9-/m1/s1 |
| InChIKey | UOEFDXYUEPHESS-SYHAXYEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus hystrix (ncbitaxon:170989) | exocarp (BTO:0000733) | PubMed (20964319) | The CH2Cl2 extract of dried and ground fruit peels |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-O-isopropyl-beta-D-glucopyranoside (CHEBI:70481) has role metabolite (CHEBI:25212) |
| 1-O-isopropyl-beta-D-glucopyranoside (CHEBI:70481) is a glycoside (CHEBI:24400) |
| Citations |
|---|