EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | C=C(C)[C@H]1CC[C@H](C)C[C@H]1O |
| InChI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10+/m0/s1 |
| InChIKey | ZYTMANIQRDEHIO-IVZWLZJFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus hystrix (ncbitaxon:170989) | exocarp (BTO:0000733) | PubMed (20964319) | The hexane extract of dried and ground fruit peels |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neo-isopulegol, rel- (CHEBI:70480) has role metabolite (CHEBI:25212) |
| neo-isopulegol, rel- (CHEBI:70480) is a p-menthane monoterpenoid (CHEBI:25186) |
| Synonym | Source |
|---|---|
| rel-(1R,2R,5S)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol | ChEBI |
| Citations |
|---|