EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O |
| Net Charge | 0 |
| Average Mass | 154.253 |
| Monoisotopic Mass | 154.13577 |
| SMILES | C=C(C)[C@@H]1CC[C@@H](C)C[C@H]1O |
| InChI | InChI=1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | ZYTMANIQRDEHIO-KXUCPTDWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus hystrix (ncbitaxon:170989) | exocarp (BTO:0000733) | PubMed (20964319) | The hexane extract of dried and ground fruit peels |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isopulegol (CHEBI:70479) has role metabolite (CHEBI:25212) |
| isopulegol (CHEBI:70479) is a p-menthane monoterpenoid (CHEBI:25186) |
| Synonyms | Source |
|---|---|
| (1R,3R,4S)-p-Menth-8-en-3-ol | ChEBI |
| Cyclohexanol, 5-methyl-2-(1-methylethenyl)-, (1R,2S,5R)- | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036078 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:89-79-2 | ChemIDplus |
| Citations |
|---|