EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O4 |
| Net Charge | 0 |
| Average Mass | 338.403 |
| Monoisotopic Mass | 338.15181 |
| SMILES | CC(C)=CCC/C(C)=C/COc1c2ccoc2cc2oc(=O)ccc12 |
| InChI | InChI=1S/C21H22O4/c1-14(2)5-4-6-15(3)9-11-24-21-16-7-8-20(22)25-19(16)13-18-17(21)10-12-23-18/h5,7-10,12-13H,4,6,11H2,1-3H3/b15-9+ |
| InChIKey | DBMJZOMNXBSRED-OQLLNIDSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus hystrix (ncbitaxon:170989) | exocarp (BTO:0000733) | PubMed (20964319) | The hexane extract of dried and ground fruit peels |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bergomottin (CHEBI:70476) has role metabolite (CHEBI:25212) |
| bergomottin (CHEBI:70476) is a furanocoumarin (CHEBI:24128) |
| Synonyms | Source |
|---|---|
| 4-{[(2E)-3,7-Dimethylocta-2,6-dien-1-yl]oxy}-7H-furo[3,2-g]chromen-7-one | ChEBI |
| 5-Geranoxypsoralen | ChEBI |
| Bergamotine | ChEBI |
| bergamottin | ChEBI |
| Bergaptin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:7380-40-7 | ChemIDplus |
| Citations |
|---|