EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H48O15 |
| Net Charge | 0 |
| Average Mass | 720.765 |
| Monoisotopic Mass | 720.29932 |
| SMILES | C/C(=C\COc1c2ccoc2cc2oc(=O)ccc12)CC[C@@H](OC(=O)CC(C)(O)CC(=O)OC[C@H]1O[C@@H](OC(C)C)[C@H](O)[C@@H](O)[C@@H]1O)C(C)(C)O |
| InChI | InChI=1S/C36H48O15/c1-19(2)48-34-32(42)31(41)30(40)25(50-34)18-47-28(38)16-36(6,44)17-29(39)51-26(35(4,5)43)9-7-20(3)11-13-46-33-21-8-10-27(37)49-24(21)15-23-22(33)12-14-45-23/h8,10-12,14-15,19,25-26,30-32,34,40-44H,7,9,13,16-18H2,1-6H3/b20-11+/t25-,26-,30-,31+,32-,34-,36?/m1/s1 |
| InChIKey | UBQMQNATXUCNPX-RCRVUDQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus hystrix (ncbitaxon:170989) | exocarp (BTO:0000733) | PubMed (20964319) | The CH2Cl2 extract of dried and ground fruit peels |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citrusoside B (CHEBI:70470) has role metabolite (CHEBI:25212) |
| citrusoside B (CHEBI:70470) is a lipopolysaccharide (CHEBI:16412) |
| Citations |
|---|