EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36O7 |
| Net Charge | 0 |
| Average Mass | 400.512 |
| Monoisotopic Mass | 400.24610 |
| SMILES | CC(C)=CCC[C@@H](C)C/C=C/C(=O)OC[C@H]1O[C@@H](OC(C)C)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H36O7/c1-13(2)8-6-9-15(5)10-7-11-17(22)26-12-16-18(23)19(24)20(25)21(28-16)27-14(3)4/h7-8,11,14-16,18-21,23-25H,6,9-10,12H2,1-5H3/b11-7+/t15-,16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | MHJOAVXYKHQVFT-NWECRORVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Citrus hystrix (ncbitaxon:170989) | exocarp (BTO:0000733) | PubMed (20964319) | The CH2Cl2 extract of dried and ground fruit peels |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citrusoside A (CHEBI:70469) has role metabolite (CHEBI:25212) |
| citrusoside A (CHEBI:70469) is a lipopolysaccharide (CHEBI:16412) |
| Synonym | Source |
|---|---|
| 1-O-isopropyl-6-O-(5'',9''-dimethyl-2'',8''-decadienoyl)-beta-D-glucopyranoside | ChEBI |
| Citations |
|---|