EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O6 |
| Net Charge | 0 |
| Average Mass | 358.390 |
| Monoisotopic Mass | 358.14164 |
| SMILES | COc1cc([C@@H]2Oc3c(OC)cc(/C=C/CO)cc3[C@H]2CO)ccc1O |
| InChI | InChI=1S/C20H22O6/c1-24-17-10-13(5-6-16(17)23)19-15(11-22)14-8-12(4-3-7-21)9-18(25-2)20(14)26-19/h3-6,8-10,15,19,21-23H,7,11H2,1-2H3/b4-3+/t15-,19+/m1/s1 |
| InChIKey | KUSXBOZNRPQEON-GWKPYITFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia foveolata (ncbitaxon:1475093) | bark (BTO:0001301) | PubMed (20939540) | Isolated from stem bark. |
| Rosa multiflora (ncbitaxon:74647) | root (BTO:0001188) | PubMed (15089032) | |
| Viburnum erosum (ncbitaxon:237937) | stem (BTO:0001300) | PubMed (24676553) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-dehydrodiconiferyl alcohol (CHEBI:70467) has role plant metabolite (CHEBI:76924) |
| (−)-dehydrodiconiferyl alcohol (CHEBI:70467) is a dehydrodiconiferyl alcohol (CHEBI:91184) |
| (−)-dehydrodiconiferyl alcohol (CHEBI:70467) is enantiomer of (+)-dehydrodiconiferyl alcohol (CHEBI:143256) |
| Incoming Relation(s) |
| (+)-dehydrodiconiferyl alcohol (CHEBI:143256) is enantiomer of (−)-dehydrodiconiferyl alcohol (CHEBI:70467) |
| IUPAC Name |
|---|
| 4-{(2R,3S)-3-(hydroxymethyl)-5-[(1E)-3-hydroxyprop-1-en-1-yl]-7-methoxy-2,3-dihydro-1-benzofuran-2-yl}-2-methoxyphenol |
| Synonyms | Source |
|---|---|
| (−)-(2R,3S)-dehydrodiconiferyl alcohol | ChEBI |
| (2R,3S)-dehydrodiconiferyl alcohol | ChEBI |
| (2R)-5-[(E)-3-Hydroxy-1-propenyl]-2,3-dihydro-2β-(4-hydroxy-3-methoxyphenyl)-7-methoxybenzofuran-3α-methanol | ChEBI |
| (7R,8S)-dehydrodiconiferyl alcohol | ChEBI |
| 7-Methoxy-5-[(E)-3-hydroxy-1-propenyl]-2β-(3-methoxy-4-hydroxyphenyl)-2,3-dihydrobenzofuran-3α-methanol | ChEBI |
| (−)-DCA | MetaCyc |
| UniProt Name | Source |
|---|---|
| (−)-dehydrodiconiferyl alcohol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-17075 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:155836-29-6 | ChEBI |
| Citations |
|---|