EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O3 |
| Net Charge | 0 |
| Average Mass | 458.727 |
| Monoisotopic Mass | 458.37600 |
| SMILES | [H][C@]12CC[C@]3([H])[C@@]([H])([C@]4(C)CC[C@@H](C(C)(C)O)O4)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C30H50O3/c1-25(2)21-12-17-29(7)22(27(21,5)15-13-23(25)31)10-9-19-20(11-16-28(19,29)6)30(8)18-14-24(33-30)26(3,4)32/h19-22,24,32H,9-18H2,1-8H3/t19-,20+,21+,22-,24+,27+,28-,29-,30+/m1/s1 |
| InChIKey | XSQYWMLMQVUWSF-FXFLHSNUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia abbreviata (IPNI:576946-1) | stem (BTO:0001300) | PubMed (21087017) | 95% ethanolic extract of air-dried stems |
| Aglaia foveolata (IPNI:968391-1) | stem (BTO:0001300) | PubMed (20939540) | Previous component: stem bark; Methanolic extract of dried stem bark |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cabraleone (CHEBI:70464) has parent hydride dammarane (CHEBI:36488) |
| cabraleone (CHEBI:70464) has role plant metabolite (CHEBI:76924) |
| cabraleone (CHEBI:70464) is a cyclic terpene ketone (CHEBI:36130) |
| cabraleone (CHEBI:70464) is a oxolanes (CHEBI:26912) |
| cabraleone (CHEBI:70464) is a tertiary alcohol (CHEBI:26878) |
| cabraleone (CHEBI:70464) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (24S)-25-hydroxy-20,24-epoxydammaran-3-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1629865 | Reaxys |
| Citations |
|---|