EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O3 |
| Net Charge | 0 |
| Average Mass | 458.727 |
| Monoisotopic Mass | 458.37600 |
| SMILES | [H][C@]12CC[C@@]3([H])[C@@](C)(CC[C@@]4(C)CC[C@@H](C(C)(C)O)O[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C30H50O3/c1-25(2)20-11-16-30(8)21(28(20,6)15-12-22(25)31)10-9-19-24-27(5,17-18-29(19,30)7)14-13-23(33-24)26(3,4)32/h19-21,23-24,32H,9-18H2,1-8H3/t19-,20+,21-,23+,24-,27-,28+,29-,30-/m1/s1 |
| InChIKey | VNZKJWBMWIOMMJ-OIGIKTIKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia foveolata (IPNI:968391-1) | stem (BTO:0001300) | PubMed (20939540) | Previous component: stem bark; Methanolic extract of dried stem bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17,24-epoxy-25-hydroxybaccharan-3-one (CHEBI:70461) has role metabolite (CHEBI:25212) |
| 17,24-epoxy-25-hydroxybaccharan-3-one (CHEBI:70461) is a organic heterotricyclic compound (CHEBI:26979) |
| 17,24-epoxy-25-hydroxybaccharan-3-one (CHEBI:70461) is a organooxygen compound (CHEBI:36963) |
| Citations |
|---|