EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O3 |
| Net Charge | 0 |
| Average Mass | 250.338 |
| Monoisotopic Mass | 250.15689 |
| SMILES | CC(C)C1=CC2=C(CO)C(=O)C[C@@H](O)[C@]2(C)CC1 |
| InChI | InChI=1S/C15H22O3/c1-9(2)10-4-5-15(3)12(6-10)11(8-16)13(17)7-14(15)18/h6,9,14,16,18H,4-5,7-8H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | ARYHWGXGRJYLNK-HUUCEWRRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aglaia foveolata (IPNI:968391-1) | stem (BTO:0001300) | PubMed (20939540) | Previous component: stem bark; Methanolic extract of dried stem bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,6-Diene-1beta,14-dihydroxyeudesma-3-one (CHEBI:70460) has role metabolite (CHEBI:25212) |
| 4,6-Diene-1beta,14-dihydroxyeudesma-3-one (CHEBI:70460) is a eudesmane sesquiterpenoid (CHEBI:62508) |
| Synonym | Source |
|---|---|
| (4R,4aR)-4-hydroxy-1-(hydroxymethyl)-4a-methyl-7-propan-2-yl-3,4,5,6-tetrahydronaphthalen-2-one | ChEBI |
| Citations |
|---|