EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O4 |
| Net Charge | 0 |
| Average Mass | 222.240 |
| Monoisotopic Mass | 222.08921 |
| SMILES | C=CCc1cc2c(c(OC)c1OC)OCO2 |
| InChI | InChI=1S/C12H14O4/c1-4-5-8-6-9-11(16-7-15-9)12(14-3)10(8)13-2/h4,6H,1,5,7H2,2-3H3 |
| InChIKey | LIKYNOPXHGPMIH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anethum graveolens (ncbitaxon:40922) | seed (BTO:0001226) | PubMed (21049975) | Essential seed oil |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dillapiole (CHEBI:70453) has role metabolite (CHEBI:25212) |
| Dillapiole (CHEBI:70453) is a benzodioxoles (CHEBI:38298) |
| Synonyms | Source |
|---|---|
| 4,5-Dimethoxy-6-(2-propenyl)-1,3-benzodioxole | ChEBI |
| Dillapiol | KEGG COMPOUND |
| Dillapiole | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002737 | KNApSAcK |
| C10449 | KEGG COMPOUND |
| HMDB0030725 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:484-31-1 | KEGG COMPOUND |
| Citations |
|---|