EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O2 |
| Net Charge | 0 |
| Average Mass | 234.299 |
| Monoisotopic Mass | 234.13683 |
| SMILES | NCCCCNC(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C13H18N2O2/c14-9-1-2-10-15-13(17)8-5-11-3-6-12(16)7-4-11/h3-8,16H,1-2,9-10,14H2,(H,15,17)/b8-5+ |
| InChIKey | CJHDBEPXEKGBDW-VMPITWQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nicotiana tabacum (ncbitaxon:4097) | - | PubMed (20954721) | |
| Buxus natalensis (IPNI:128681-1) | bark (BTO:0001301) | PubMed (20954721) | MeOH extract of pulverized bark |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-coumaroylputrescine (CHEBI:70431) has role metabolite (CHEBI:25212) |
| p-coumaroylputrescine (CHEBI:70431) is a hydroxycinnamic acid (CHEBI:24689) |
| Synonym | Source |
|---|---|
| (E)-N-(4-aminobutyl)-3-(4-hydroxyphenyl)prop-2-enamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C18326 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:34136-53-3 | KEGG COMPOUND |
| Citations |
|---|