EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H46N2O4 |
| Net Charge | 0 |
| Average Mass | 534.741 |
| Monoisotopic Mass | 534.34576 |
| SMILES | [H][C@]1([C@H](C)N(C)C)[C@H](O)C[C@]2(C)[C@]1(C)CC=C1C[C@@]34C=C[C@H](NC(=O)c5ccccc5)[C@@](C)(CO3)[C@]4([H])[C@@H](O)C[C@]12[H] |
| InChI | InChI=1S/C33H46N2O4/c1-20(35(5)6)27-25(37)18-32(4)23-16-24(36)28-30(2)19-39-33(28,17-22(23)12-14-31(27,32)3)15-13-26(30)34-29(38)21-10-8-7-9-11-21/h7-13,15,20,23-28,36-37H,14,16-19H2,1-6H3,(H,34,38)/t20-,23+,24-,25+,26-,27-,28-,30+,31+,32-,33+/m0/s1 |
| InChIKey | FBMFMDSVTBIJPB-CKTRUMDJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Buxus natalensis (IPNI:128681-1) | bark (BTO:0001301) | PubMed (20954721) | MeOH extract of pulverized bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O10-natafuranamine (CHEBI:70422) has role metabolite (CHEBI:25212) |
| O10-natafuranamine (CHEBI:70422) is a sesquiterpenoid (CHEBI:26658) |
| Citations |
|---|