EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H48N2O6 |
| Net Charge | 0 |
| Average Mass | 592.777 |
| Monoisotopic Mass | 592.35124 |
| SMILES | [H][C@]1([C@H](C)N(C)C)[C@H](O)C[C@]2(C)[C@]1(C)CC=C1C[C@@]34O[C@]3([H])[C@H]3OC[C@](C)([C@H]3NC(=O)c3ccccc3)[C@]4([H])[C@@H](OC(C)=O)C[C@]12[H] |
| InChI | InChI=1S/C35H48N2O6/c1-19(37(6)7)26-24(39)17-34(5)23-15-25(42-20(2)38)28-32(3)18-41-27(29(32)36-31(40)21-11-9-8-10-12-21)30-35(28,43-30)16-22(23)13-14-33(26,34)4/h8-13,19,23-30,39H,14-18H2,1-7H3,(H,36,40)/t19-,23+,24+,25-,26-,27-,28-,29-,30+,32-,33+,34-,35-/m0/s1 |
| InChIKey | OMPGPMBHVLLRMF-FGCNPPJOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Buxus natalensis (IPNI:128681-1) | bark (BTO:0001301) | PubMed (20954721) | MeOH extract of pulverized bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O2-natafuranamine (CHEBI:70421) has role metabolite (CHEBI:25212) |
| O2-natafuranamine (CHEBI:70421) is a sesquiterpenoid (CHEBI:26658) |
| Citations |
|---|