EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:70420 - 2-amino-4-formylaminooxy-but-3E-enoic acid
| Formula | C5H8N2O4 |
| Net Charge | 0 |
| Average Mass | 160.129 |
| Monoisotopic Mass | 160.04841 |
| SMILES | N[C@@H](/C=C/ONC=O)C(=O)O |
| InChI | InChI=1S/C5H8N2O4/c6-4(5(9)10)1-2-11-7-3-8/h1-4H,6H2,(H,7,8)(H,9,10)/b2-1+/t4-/m0/s1 |
| InChIKey | BICCALWGKRVQAV-QPHDTYRISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas fluorescens (ncbitaxon:294) | - | PubMed (20979386) | Strain: D7 |
| Pseudomonas fluorescens A506 (ncbitaxon:1037911) | - | PubMed (20979386) | |
| Pseudomonas fluorescens Pf0-1 (ncbitaxon:205922) | - | PubMed (20979386) | |
| Pseudomonas fluorescens PF5 (ncbitaxon:1218948) | - | PubMed (20979386) | |
| Pseudomonas fluorescens WH6 (ncbitaxon:746360) | - | PubMed (20979386) | 90% EtOH extraction of dried culture filtrate |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-formylaminooxy-but-3E-enoic acid (CHEBI:70420) has role metabolite (CHEBI:25212) |
| 2-amino-4-formylaminooxy-but-3E-enoic acid (CHEBI:70420) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonyms | Source |
|---|---|
| 4-formylaminooxyvinylglycine | ChEBI |
| germination-arrest factor | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 28288253 | ChemSpider |
| Citations |
|---|