EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | [H][C@]1(C=C)[C@]2(C)CC[C@@]3(C)[C@]4([H])CC(C)(C)CC[C@]4(C)CC[C@]3(C)[C@@]2([H])CC[C@]1(C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C30H50O2/c1-10-21-27(6,20(2)24(31)32)12-11-22-28(21,7)16-18-30(9)23-19-25(3,4)13-14-26(23,5)15-17-29(22,30)8/h10,20-23H,1,11-19H2,2-9H3,(H,31,32)/t20-,21+,22-,23+,26+,27+,28-,29+,30-/m0/s1 |
| InChIKey | JIJBCKTUZZUZGI-DIEYUIMASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcia parviflora (IPNI:107401-2) | |||
| branch (BTO:0000148) | PubMed (20958014) | n-hexane extract of air-dried, powdered branch and leaves | |
| leaf (BTO:0000713) | PubMed (20958014) | n-hexane extract of air-dried, powdered branch and leaves |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-dehydro-2,3-secofriedelan-3-oic acid (CHEBI:70414) has role plant metabolite (CHEBI:76924) |
| 1,2-dehydro-2,3-secofriedelan-3-oic acid (CHEBI:70414) is a monocarboxylic acid (CHEBI:25384) |
| 1,2-dehydro-2,3-secofriedelan-3-oic acid (CHEBI:70414) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (2R)-2-[(1S,2S,4aS,4bR,6aR,10aR,10bS,12aR)-1-ethenyl-2,4b,6a,9,9,10b,12a-heptamethyloctadecahydrochrysen-2-yl]propanoic acid |
| Citations |
|---|