EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O2 |
| Net Charge | 0 |
| Average Mass | 414.674 |
| Monoisotopic Mass | 414.34978 |
| SMILES | Cc1c(O)cc2c(c1C)OC(C)(CCCC(C)CCCC(C)CCCC(C)C)C=C2 |
| InChI | InChI=1S/C28H46O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-19-26(29)23(5)24(6)27(25)30-28/h16,18-22,29H,8-15,17H2,1-7H3 |
| InChIKey | BIXWVSLNTIFDQN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stemona cochinchinensis (IPNI:821984-1) | root (BTO:0001188) | PubMed (21049906) | |
| Stemona curtisii (ncbitaxon:492018) | root (BTO:0001188) | PubMed (21049906) | 95% EtOH extract of dry, ground roots |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehydro-gamma-tocopherol (CHEBI:70411) has role metabolite (CHEBI:25212) |
| dehydro-gamma-tocopherol (CHEBI:70411) is a tocopherol (CHEBI:27013) |
| Citations |
|---|