EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25NO6 |
| Net Charge | 0 |
| Average Mass | 363.410 |
| Monoisotopic Mass | 363.16819 |
| SMILES | [H][C@]12[C@H](C)/C(=C3/OC(=O)C(C)=C3OC)O[C@]13CCC[N+]1([O-])CCC[C@@H](O3)[C@@]21[H] |
| InChI | InChI=1S/C19H25NO6/c1-10-13-14-12-6-4-8-20(14,22)9-5-7-19(13,25-12)26-16(10)17-15(23-3)11(2)18(21)24-17/h10,12-14H,4-9H2,1-3H3/b17-16-/t10-,12+,13+,14-,19+,20?/m0/s1 |
| InChIKey | NBMMUYZDDIKEKL-HPMMXFFJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stemona curtisii (ncbitaxon:492018) | root (BTO:0001188) | PubMed (21049906) | 95% EtOH extract of dry, ground roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stemocurtisine N-oxide (CHEBI:70406) has role metabolite (CHEBI:25212) |
| stemocurtisine N-oxide (CHEBI:70406) is a furofuran (CHEBI:47790) |
| stemocurtisine N-oxide (CHEBI:70406) is a tertiary amine oxide (CHEBI:134363) |
| Citations |
|---|