EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32N3O5 |
| Net Charge | +1 |
| Average Mass | 454.547 |
| Monoisotopic Mass | 454.23365 |
| SMILES | [H][C@@]12CCC[NH+]1C[C@]1([N+](=O)[O-])C[C@]3(C(=O)Nc4c3ccc3c4C(=O)CC(C)(C)O3)C(C)(C)[C@@]1([H])C2 |
| InChI | InChI=1S/C25H31N3O5/c1-22(2)11-16(29)19-17(33-22)8-7-15-20(19)26-21(30)25(15)12-24(28(31)32)13-27-9-5-6-14(27)10-18(24)23(25,3)4/h7-8,14,18H,5-6,9-13H2,1-4H3,(H,26,30)/p+1/t14-,18+,24+,25-/m0/s1 |
| InChIKey | QVBARITWSQCBBV-DTKOROOESA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium citrinum (ncbitaxon:5077) | - | PubMed (21053938) | Penicillium species isolated from a seaweed caulerpa sp. Strain: F53 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| citrinalin A (CHEBI:70403) has functional parent δ-amino acid (CHEBI:35931) |
| citrinalin A (CHEBI:70403) has role metabolite (CHEBI:25212) |
| citrinalin A (CHEBI:70403) is a organonitrogen compound (CHEBI:35352) |
| citrinalin A (CHEBI:70403) is a organooxygen compound (CHEBI:36963) |
| Citations |
|---|