EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H25NO2 |
| Net Charge | 0 |
| Average Mass | 251.370 |
| Monoisotopic Mass | 251.18853 |
| SMILES | CCCCCCCC(=O)C(C)C(=O)N1C=CCC1 |
| InChI | InChI=1S/C15H25NO2/c1-3-4-5-6-7-10-14(17)13(2)15(18)16-11-8-9-12-16/h8,11,13H,3-7,9-10,12H2,1-2H3 |
| InChIKey | HMWIYUSLKIYYER-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium brevicompactum (ncbitaxon:5074) | - | PubMed (21053938) | |
| Penicillium citrinum (ncbitaxon:5077) | - | PubMed (21053938) | Penicillium species isolated from a seaweed caulerpa sp. Strain: F53 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(2,3-dihydro-1H-pyrrol-1-yl)-2-methyldecane-1,3-dione (CHEBI:70402) has role Penicillium metabolite (CHEBI:76964) |
| 1-(2,3-dihydro-1H-pyrrol-1-yl)-2-methyldecane-1,3-dione (CHEBI:70402) has role antifungal agent (CHEBI:35718) |
| 1-(2,3-dihydro-1H-pyrrol-1-yl)-2-methyldecane-1,3-dione (CHEBI:70402) is a ketone (CHEBI:17087) |
| 1-(2,3-dihydro-1H-pyrrol-1-yl)-2-methyldecane-1,3-dione (CHEBI:70402) is a monocarboxylic acid amide (CHEBI:29347) |
| 1-(2,3-dihydro-1H-pyrrol-1-yl)-2-methyldecane-1,3-dione (CHEBI:70402) is a pyrroles (CHEBI:26455) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8211286 | Reaxys |
| Citations |
|---|