EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23N5O4 |
| Net Charge | 0 |
| Average Mass | 433.468 |
| Monoisotopic Mass | 433.17500 |
| SMILES | C=CC(C)(C)[C@]12C=C(O)C(=O)N3/C(=C/c4cncn4)C(=O)N[C@@]31N(OC)c1ccccc12 |
| InChI | InChI=1S/C23H23N5O4/c1-5-21(2,3)22-11-18(29)20(31)27-17(10-14-12-24-13-25-14)19(30)26-23(22,27)28(32-4)16-9-7-6-8-15(16)22/h5-13,29H,1H2,2-4H3,(H,24,25)(H,26,30)/b17-10+/t22-,23-/m1/s1 |
| InChIKey | JTJJJLSLKZFEPJ-WSHSOXHMSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium oxalicum (ncbitaxon:69781) | - | PubMed (21053938) | Strain: F30 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meleagrine (CHEBI:70399) has functional parent glandicoline B (CHEBI:134347) |
| meleagrine (CHEBI:70399) has role Penicillium metabolite (CHEBI:76964) |
| meleagrine (CHEBI:70399) is a enol (CHEBI:33823) |
| meleagrine (CHEBI:70399) is a imidazoles (CHEBI:24780) |
| meleagrine (CHEBI:70399) is a indole alkaloid (CHEBI:38958) |
| meleagrine (CHEBI:70399) is a lactam (CHEBI:24995) |
| meleagrine (CHEBI:70399) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| (3E,7aS,12aR)-6-hydroxy-3-(1H-imidazol-4-ylmethylidene)-12-methoxy-7a-(2-methylbut-3-en-2-yl)-7a,12-dihydro-1H,5H-imidazo[1',2':1,2]pyrido[2,3-b]indole-2,5(3H)-dione |
| UniProt Name | Source |
|---|---|
| meleagrin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Meleagrin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5782385 | Reaxys |
| CAS:71751-77-4 | ChemIDplus |
| Citations |
|---|