EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H22O10 |
| Net Charge | 0 |
| Average Mass | 542.496 |
| Monoisotopic Mass | 542.12130 |
| SMILES | COc1c(OC)c(-c2c(OC)c(OC)c(O)c3oc4ccccc4c(=O)c23)c2c(=O)c3ccccc3oc2c1O |
| InChI | InChI=1S/C30H22O10/c1-35-27-17(19-21(31)13-9-5-7-11-15(13)39-25(19)23(33)29(27)37-3)18-20-22(32)14-10-6-8-12-16(14)40-26(20)24(34)30(38-4)28(18)36-2/h5-12,33-34H,1-4H3 |
| InChIKey | BIXXTGSNLBGJIC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum chinense (IPNI:433315-1) | root (BTO:0001188) | PubMed (21043475) | Ethyl acetate soluble fraction of roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hyperidixanthone (CHEBI:70398) has role metabolite (CHEBI:25212) |
| hyperidixanthone (CHEBI:70398) is a tannin (CHEBI:26848) |
| Synonym | Source |
|---|---|
| 1-[4'-hydroxy-2',3'-dimethoxy-1'-xanthonyl]-4-hydroxy-2,3-dimethoxyxanthone | ChEBI |
| Citations |
|---|